C30H28O6 — CID 123611050
2-[4-[[8-[(4-acetyloxyphenyl)methyl]-2,7-dimethoxynaphthalen-1-yl]methyl]phenyl]acetic acid (PubChem CID 123611050) has the molecular formula C30H28O6 and a molecular weight of 484.55 g/mol. Its IUPAC name is 2-[4-[[8-[(4-acetyloxyphenyl)methyl]-2,7-dimethoxynaphthalen-1-yl]methyl]phenyl]acetic acid.
| Compound Name | 2-[4-[[8-[(4-acetyloxyphenyl)methyl]-2,7-dimethoxynaphthalen-1-yl]methyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 123611050 |
| Molecular Formula | C30H28O6 |
| Molecular Weight | 484.55 g/mol |
| Exact Mass | 484.19 |
| IUPAC Name | 2-[4-[[8-[(4-acetyloxyphenyl)methyl]-2,7-dimethoxynaphthalen-1-yl]methyl]phenyl]acetic acid |
| SMILES | COc1ccc2ccc(OC)c(Cc3ccc(OC(C)=O)cc3)c2c1Cc1ccc(CC(=O)O)cc1 |
| InChI | InChI=1S/C30H28O6/c1-19(31)36-24-12-8-21(9-13-24)17-26-28(35-3)15-11-23-10-14-27(34-2)25(30(23)26)16-20-4-6-22(7-5-20)18-29(32)33/h4-15H,16-18H2,1-3H3,(H,32,33) |
| InChIKey | DAHFEEWDIZBABA-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.55 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|