C16H18O3 — CID 123611826
2-methyl-6-(3-methyl-7-oxoocta-2,5-dienyl)cyclohexa-2,5-diene-1,4-dione (PubChem CID 123611826) has the molecular formula C16H18O3 and a molecular weight of 258.32 g/mol. Its IUPAC name is 2-methyl-6-(3-methyl-7-oxoocta-2,5-dienyl)cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-methyl-6-(3-methyl-7-oxoocta-2,5-dienyl)cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 123611826 |
| Molecular Formula | C16H18O3 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | 2-methyl-6-(3-methyl-7-oxoocta-2,5-dienyl)cyclohexa-2,5-diene-1,4-dione |
| SMILES | CC(=O)C=CCC(C)=CCC1=CC(=O)C=C(C)C1=O |
| InChI | InChI=1S/C16H18O3/c1-11(5-4-6-13(3)17)7-8-14-10-15(18)9-12(2)16(14)19/h4,6-7,9-10H,5,8H2,1-3H3 |
| InChIKey | TWUGTWWCFXHNCH-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|