C32H34BF3N2O7 — CID 123612124
2-[[4-[[2-[4-methoxy-2-(trifluoromethyl)phenyl]acetyl]amino]benzoyl]-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]amino]acetic acid (PubChem CID 123612124) has the molecular formula C32H34BF3N2O7 and a molecular weight of 626.44 g/mol. Its IUPAC name is 2-[[4-[[2-[4-methoxy-2-(trifluoromethyl)phenyl]acetyl]amino]benzoyl]-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]amino]acetic acid.
| Compound Name | 2-[[4-[[2-[4-methoxy-2-(trifluoromethyl)phenyl]acetyl]amino]benzoyl]-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]amino]acetic acid |
|---|---|
| PubChem CID | 123612124 |
| Molecular Formula | C32H34BF3N2O7 |
| Molecular Weight | 626.44 g/mol |
| Exact Mass | 626.24 |
| IUPAC Name | 2-[[4-[[2-[4-methoxy-2-(trifluoromethyl)phenyl]acetyl]amino]benzoyl]-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]amino]acetic acid |
| SMILES | COc1ccc(CC(=O)Nc2ccc(C(=O)N(CC(=O)O)Cc3ccc(B4OC(C)(C)C(C)(C)O4)cc3)cc2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C32H34BF3N2O7/c1-30(2)31(3,4)45-33(44-30)23-11-6-20(7-12-23)18-38(19-28(40)41)29(42)21-8-13-24(14-9-21)37-27(39)16-22-10-15-25(43-5)17-26(22)32(34,35)36/h6-15,17H,16,18-19H2,1-5H3,(H,37,39)(H,40,41) |
| InChIKey | PJHFXNHMAYFVHI-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 114.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.44 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|