C30H30F3IN2O5 — CID 71111625
tert-butyl 2-[(4-iodophenyl)methyl-[4-[[2-[4-methoxy-2-(trifluoromethyl)phenyl]acetyl]amino]benzoyl]amino]acetate (PubChem CID 71111625) has the molecular formula C30H30F3IN2O5 and a molecular weight of 682.48 g/mol. Its IUPAC name is tert-butyl 2-[(4-iodophenyl)methyl-[4-[[2-[4-methoxy-2-(trifluoromethyl)phenyl]acetyl]amino]benzoyl]amino]acetate.
| Compound Name | tert-butyl 2-[(4-iodophenyl)methyl-[4-[[2-[4-methoxy-2-(trifluoromethyl)phenyl]acetyl]amino]benzoyl]amino]acetate |
|---|---|
| PubChem CID | 71111625 |
| Molecular Formula | C30H30F3IN2O5 |
| Molecular Weight | 682.48 g/mol |
| Exact Mass | 682.12 |
| IUPAC Name | tert-butyl 2-[(4-iodophenyl)methyl-[4-[[2-[4-methoxy-2-(trifluoromethyl)phenyl]acetyl]amino]benzoyl]amino]acetate |
| SMILES | COc1ccc(CC(=O)Nc2ccc(C(=O)N(CC(=O)OC(C)(C)C)Cc3ccc(I)cc3)cc2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C30H30F3IN2O5/c1-29(2,3)41-27(38)18-36(17-19-5-10-22(34)11-6-19)28(39)20-7-12-23(13-8-20)35-26(37)15-21-9-14-24(40-4)16-25(21)30(31,32)33/h5-14,16H,15,17-18H2,1-4H3,(H,35,37) |
| InChIKey | CLCBENUZDARNQH-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.48 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|