C10H18N2 — CID 123612288
1-N,3-N,2,2-tetramethylhex-4-ene-1,3-diimine (PubChem CID 123612288) has the molecular formula C10H18N2 and a molecular weight of 166.27 g/mol. Its IUPAC name is 1-N,3-N,2,2-tetramethylhex-4-ene-1,3-diimine.
| Compound Name | 1-N,3-N,2,2-tetramethylhex-4-ene-1,3-diimine |
|---|---|
| PubChem CID | 123612288 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | 1-N,3-N,2,2-tetramethylhex-4-ene-1,3-diimine |
| SMILES | CC=C/C(=N\C)C(C)(C)/C=N/C |
| InChI | InChI=1S/C10H18N2/c1-6-7-9(12-5)10(2,3)8-11-4/h6-8H,1-5H3/b7-6?,11-8+,12-9+ |
| InChIKey | XWGLODIITLNCEM-NPCGNDIMSA-N |
| XLogP | 2.36 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|