C21H31N5 — CID 123613136
N-[4-butan-2-ylidene-6-methyl-2-(4-methylpiperazin-1-yl)quinazolin-3-yl]propan-2-imine (PubChem CID 123613136) has the molecular formula C21H31N5 and a molecular weight of 353.51 g/mol. Its IUPAC name is N-[4-butan-2-ylidene-6-methyl-2-(4-methylpiperazin-1-yl)quinazolin-3-yl]propan-2-imine.
| Compound Name | N-[4-butan-2-ylidene-6-methyl-2-(4-methylpiperazin-1-yl)quinazolin-3-yl]propan-2-imine |
|---|---|
| PubChem CID | 123613136 |
| Molecular Formula | C21H31N5 |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.26 |
| IUPAC Name | N-[4-butan-2-ylidene-6-methyl-2-(4-methylpiperazin-1-yl)quinazolin-3-yl]propan-2-imine |
| SMILES | CCC(C)=C1c2cc(C)ccc2N=C(N2CCN(C)CC2)N1N=C(C)C |
| InChI | InChI=1S/C21H31N5/c1-7-17(5)20-18-14-16(4)8-9-19(18)22-21(26(20)23-15(2)3)25-12-10-24(6)11-13-25/h8-9,14H,7,10-13H2,1-6H3 |
| InChIKey | ZFXPRQWKMBKGCP-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 34.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|