C20H28ClN5 — CID 143957753
N-[4-butan-2-ylidene-7-chloro-2-(4-methylpiperazin-1-yl)quinazolin-3-yl]propan-2-imine (PubChem CID 143957753) has the molecular formula C20H28ClN5 and a molecular weight of 373.93 g/mol. Its IUPAC name is N-[4-butan-2-ylidene-7-chloro-2-(4-methylpiperazin-1-yl)quinazolin-3-yl]propan-2-imine.
| Compound Name | N-[4-butan-2-ylidene-7-chloro-2-(4-methylpiperazin-1-yl)quinazolin-3-yl]propan-2-imine |
|---|---|
| PubChem CID | 143957753 |
| Molecular Formula | C20H28ClN5 |
| Molecular Weight | 373.93 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | N-[4-butan-2-ylidene-7-chloro-2-(4-methylpiperazin-1-yl)quinazolin-3-yl]propan-2-imine |
| SMILES | CCC(C)=C1c2ccc(Cl)cc2N=C(N2CCN(C)CC2)N1N=C(C)C |
| InChI | InChI=1S/C20H28ClN5/c1-6-15(4)19-17-8-7-16(21)13-18(17)22-20(26(19)23-14(2)3)25-11-9-24(5)10-12-25/h7-8,13H,6,9-12H2,1-5H3 |
| InChIKey | CLIZANPBPWUKCA-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 34.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.93 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|