C18H18BClN4 — CID 159628919
CID 159628919 (PubChem CID 159628919) has the molecular formula C18H18BClN4 and a molecular weight of 336.64 g/mol.
| Compound Name | CID 159628919 |
|---|---|
| PubChem CID | 159628919 |
| Molecular Formula | C18H18BClN4 |
| Molecular Weight | 336.64 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | — |
| SMILES | [B]N1c2ccc(Cl)cc2N=C(N2CCN(C)CC2)c2ccccc21 |
| InChI | InChI=1S/C18H18BClN4/c1-22-8-10-23(11-9-22)18-14-4-2-3-5-16(14)24(19)17-7-6-13(20)12-15(17)21-18/h2-7,12H,8-11H2,1H3 |
| InChIKey | XTKVAFFDSDXMMG-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 22.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.64 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|