C21H23N3O5S — CID 70600715
but-2-enedioic acid;8-methyl-4-(4-methylpiperazin-1-yl)thieno[3,4-b][1,5]benzoxazepine (PubChem CID 70600715) has the molecular formula C21H23N3O5S and a molecular weight of 429.50 g/mol. Its IUPAC name is but-2-enedioic acid;8-methyl-4-(4-methylpiperazin-1-yl)thieno[3,4-b][1,5]benzoxazepine.
| Compound Name | but-2-enedioic acid;8-methyl-4-(4-methylpiperazin-1-yl)thieno[3,4-b][1,5]benzoxazepine |
|---|---|
| PubChem CID | 70600715 |
| Molecular Formula | C21H23N3O5S |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | but-2-enedioic acid;8-methyl-4-(4-methylpiperazin-1-yl)thieno[3,4-b][1,5]benzoxazepine |
| SMILES | Cc1ccc2c(c1)Oc1cscc1C(N1CCN(C)CC1)=N2.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C17H19N3OS.C4H4O4/c1-12-3-4-14-15(9-12)21-16-11-22-10-13(16)17(18-14)20-7-5-19(2)6-8-20;5-3(6)1-2-4(7)8/h3-4,9-11H,5-8H2,1-2H3;1-2H,(H,5,6)(H,7,8) |
| InChIKey | NMBLHDXWENTLPW-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 102.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|