C25H23N3O5S — CID 91164760
2-[8-methyl-12-(4-methylpiperazin-1-yl)-[1]benzothiolo[2,3-b][1,5]benzoxazepin-2-yl]but-2-enedioic acid (PubChem CID 91164760) has the molecular formula C25H23N3O5S and a molecular weight of 477.54 g/mol. Its IUPAC name is 2-[8-methyl-12-(4-methylpiperazin-1-yl)-[1]benzothiolo[2,3-b][1,5]benzoxazepin-2-yl]but-2-enedioic acid.
| Compound Name | 2-[8-methyl-12-(4-methylpiperazin-1-yl)-[1]benzothiolo[2,3-b][1,5]benzoxazepin-2-yl]but-2-enedioic acid |
|---|---|
| PubChem CID | 91164760 |
| Molecular Formula | C25H23N3O5S |
| Molecular Weight | 477.54 g/mol |
| Exact Mass | 477.14 |
| IUPAC Name | 2-[8-methyl-12-(4-methylpiperazin-1-yl)-[1]benzothiolo[2,3-b][1,5]benzoxazepin-2-yl]but-2-enedioic acid |
| SMILES | Cc1ccc2c(c1)Oc1sc3ccc(C(=CC(=O)O)C(=O)O)cc3c1C(N1CCN(C)CC1)=N2 |
| InChI | InChI=1S/C25H23N3O5S/c1-14-3-5-18-19(11-14)33-25-22(23(26-18)28-9-7-27(2)8-10-28)17-12-15(4-6-20(17)34-25)16(24(31)32)13-21(29)30/h3-6,11-13H,7-10H2,1-2H3,(H,29,30)(H,31,32) |
| InChIKey | BLUAVBUWQVCGND-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 102.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.54 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|