C25H25N3O6S — CID 70247255
2-[8-methyl-12-(4-methylpiperazin-1-yl)-[1]benzothiolo[2,3-b][1,5]benzoxazepin-1-yl]but-2-enedioic acid;hydrate (PubChem CID 70247255) has the molecular formula C25H25N3O6S and a molecular weight of 495.56 g/mol. Its IUPAC name is 2-[8-methyl-12-(4-methylpiperazin-1-yl)-[1]benzothiolo[2,3-b][1,5]benzoxazepin-1-yl]but-2-enedioic acid;hydrate.
| Compound Name | 2-[8-methyl-12-(4-methylpiperazin-1-yl)-[1]benzothiolo[2,3-b][1,5]benzoxazepin-1-yl]but-2-enedioic acid;hydrate |
|---|---|
| PubChem CID | 70247255 |
| Molecular Formula | C25H25N3O6S |
| Molecular Weight | 495.56 g/mol |
| Exact Mass | 495.15 |
| IUPAC Name | 2-[8-methyl-12-(4-methylpiperazin-1-yl)-[1]benzothiolo[2,3-b][1,5]benzoxazepin-1-yl]but-2-enedioic acid;hydrate |
| SMILES | Cc1ccc2c(c1)Oc1sc3cccc(C(=CC(=O)O)C(=O)O)c3c1C(N1CCN(C)CC1)=N2.O |
| InChI | InChI=1S/C25H23N3O5S.H2O/c1-14-6-7-17-18(12-14)33-25-22(23(26-17)28-10-8-27(2)9-11-28)21-15(4-3-5-19(21)34-25)16(24(31)32)13-20(29)30;/h3-7,12-13H,8-11H2,1-2H3,(H,29,30)(H,31,32);1H2 |
| InChIKey | PTMIZLQKKBMAPO-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 134.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.56 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|