C9H12OS — CID 123614418
6-methyl-2,3,7,8-tetrahydro-1,4-benzoxathiine (PubChem CID 123614418) has the molecular formula C9H12OS and a molecular weight of 168.26 g/mol. Its IUPAC name is 6-methyl-2,3,7,8-tetrahydro-1,4-benzoxathiine.
| Compound Name | 6-methyl-2,3,7,8-tetrahydro-1,4-benzoxathiine |
|---|---|
| PubChem CID | 123614418 |
| Molecular Formula | C9H12OS |
| Molecular Weight | 168.26 g/mol |
| Exact Mass | 168.06 |
| IUPAC Name | 6-methyl-2,3,7,8-tetrahydro-1,4-benzoxathiine |
| SMILES | CC1=CC2=C(CC1)OCCS2 |
| InChI | InChI=1S/C9H12OS/c1-7-2-3-8-9(6-7)11-5-4-10-8/h6H,2-5H2,1H3 |
| InChIKey | OOXRWLBSFLBWRH-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.26 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |