C12H17N5O2 — CID 123615540
1-pyrimidin-2-yl-1,3,8-triazaspiro[4.5]decane-6-carboxylic acid (PubChem CID 123615540) has the molecular formula C12H17N5O2 and a molecular weight of 263.30 g/mol. Its IUPAC name is 1-pyrimidin-2-yl-1,3,8-triazaspiro[4.5]decane-6-carboxylic acid.
| Compound Name | 1-pyrimidin-2-yl-1,3,8-triazaspiro[4.5]decane-6-carboxylic acid |
|---|---|
| PubChem CID | 123615540 |
| Molecular Formula | C12H17N5O2 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | 1-pyrimidin-2-yl-1,3,8-triazaspiro[4.5]decane-6-carboxylic acid |
| SMILES | O=C(O)C1CNCCC12CNCN2c1ncccn1 |
| InChI | InChI=1S/C12H17N5O2/c18-10(19)9-6-13-5-2-12(9)7-14-8-17(12)11-15-3-1-4-16-11/h1,3-4,9,13-14H,2,5-8H2,(H,18,19) |
| InChIKey | WXLHORXAVHMVIL-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 90.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |