1-pyrimidin-2-yl-1,3,8-triazaspiro[4.5]decane-6-carboxylic acid

C12H17N5O2 — CID 123615540

IUPAC1-pyrimidin-2-yl-1,3,8-triazaspiro[4.5]decane-6-carboxylic acid
SMILESO=C(O)C1CNCCC12CNCN2c1ncccn1
InChIInChI=1S/C12H17N5O2/c18-10(19)9-6-13-5-2-12(9)7-14-8-17(12)11-15-3-1-4-16-11/h1,3-4,9,13-14H,2,5-8H2,(H,18,19)
InChIKeyWXLHORXAVHMVIL-UHFFFAOYSA-N
MW263.30 g/mol
LogP-0.72
Rot. Bonds2

About 1-pyrimidin-2-yl-1,3,8-triazaspiro[4.5]decane-6-carboxylic acid

1-pyrimidin-2-yl-1,3,8-triazaspiro[4.5]decane-6-carboxylic acid (PubChem CID 123615540) has the molecular formula C12H17N5O2 and a molecular weight of 263.30 g/mol. Its IUPAC name is 1-pyrimidin-2-yl-1,3,8-triazaspiro[4.5]decane-6-carboxylic acid.

Molecular Properties

Compound Name1-pyrimidin-2-yl-1,3,8-triazaspiro[4.5]decane-6-carboxylic acid
PubChem CID123615540
Molecular FormulaC12H17N5O2
Molecular Weight263.30 g/mol
Exact Mass263.14
IUPAC Name1-pyrimidin-2-yl-1,3,8-triazaspiro[4.5]decane-6-carboxylic acid
SMILESO=C(O)C1CNCCC12CNCN2c1ncccn1
InChIInChI=1S/C12H17N5O2/c18-10(19)9-6-13-5-2-12(9)7-14-8-17(12)11-15-3-1-4-16-11/h1,3-4,9,13-14H,2,5-8H2,(H,18,19)
InChIKeyWXLHORXAVHMVIL-UHFFFAOYSA-N
XLogP-0.72
TPSA90.38 Ų
H-Bond Donors3
H-Bond Acceptors6
Rotatable Bonds2
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500263.30
LogP ≤ 5-0.72
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 106

Analyze 1-pyrimidin-2-yl-1,3,8-triazaspiro[4.5]decane-6-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-pyrimidin-2-yl-1,3,8-triazaspiro[4.5]decane-6-carboxylic acid?
The IUPAC name of 1-pyrimidin-2-yl-1,3,8-triazaspiro[4.5]decane-6-carboxylic acid (CID 123615540) is 1-pyrimidin-2-yl-1,3,8-triazaspiro[4.5]decane-6-carboxylic acid.
What is the SMILES notation for 1-pyrimidin-2-yl-1,3,8-triazaspiro[4.5]decane-6-carboxylic acid?
The canonical SMILES for 1-pyrimidin-2-yl-1,3,8-triazaspiro[4.5]decane-6-carboxylic acid is O=C(O)C1CNCCC12CNCN2c1ncccn1.
What is the InChIKey of 1-pyrimidin-2-yl-1,3,8-triazaspiro[4.5]decane-6-carboxylic acid?
The InChIKey is WXLHORXAVHMVIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N5O2/c18-10(19)9-6-13-5-2-12(9)7-14-8-17(12)11-15-3-1-4-16-11/h1,3-4,9,13-14H,2,5-8H2,(H,18,19).
What are the key properties of 1-pyrimidin-2-yl-1,3,8-triazaspiro[4.5]decane-6-carboxylic acid?
1-pyrimidin-2-yl-1,3,8-triazaspiro[4.5]decane-6-carboxylic acid has a molecular weight of 263.30 g/mol, XLogP of -0.72, 2 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-pyrimidin-2-yl-1,3,8-triazaspiro[4.5]decane-6-carboxylic acid is sourced from PubChem (CID 123615540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).