C16H33N — CID 123615582
8-ethyl-3,6,7,7-tetramethyldecan-5-imine (PubChem CID 123615582) has the molecular formula C16H33N and a molecular weight of 239.45 g/mol. Its IUPAC name is 8-ethyl-3,6,7,7-tetramethyldecan-5-imine.
| Compound Name | 8-ethyl-3,6,7,7-tetramethyldecan-5-imine |
|---|---|
| PubChem CID | 123615582 |
| Molecular Formula | C16H33N |
| Molecular Weight | 239.45 g/mol |
| Exact Mass | 239.26 |
| IUPAC Name | 8-ethyl-3,6,7,7-tetramethyldecan-5-imine |
| SMILES | [H]/N=C(\CC(C)CC)C(C)C(C)(C)C(CC)CC |
| InChI | InChI=1S/C16H33N/c1-8-12(4)11-15(17)13(5)16(6,7)14(9-2)10-3/h12-14,17H,8-11H2,1-7H3/b17-15+ |
| InChIKey | VIWVTNJHSWQONY-BMRADRMJSA-N |
| XLogP | 5.54 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.45 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|