C9H14O2 — CID 123615702
4-methoxy-2,5-dimethylcyclohex-2-en-1-one (PubChem CID 123615702) has the molecular formula C9H14O2 and a molecular weight of 154.21 g/mol. Its IUPAC name is 4-methoxy-2,5-dimethylcyclohex-2-en-1-one.
| Compound Name | 4-methoxy-2,5-dimethylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 123615702 |
| Molecular Formula | C9H14O2 |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.10 |
| IUPAC Name | 4-methoxy-2,5-dimethylcyclohex-2-en-1-one |
| SMILES | COC1C=C(C)C(=O)CC1C |
| InChI | InChI=1S/C9H14O2/c1-6-5-9(11-3)7(2)4-8(6)10/h5,7,9H,4H2,1-3H3 |
| InChIKey | FTHGPZJKAXTHDA-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |