C16H21FO3 — CID 169186239
3-[(4,7-dimethyl-6-oxo-2,4a,5,8a-tetrahydrochromen-2-yl)methyl]but-3-enyl hypofluorite (PubChem CID 169186239) has the molecular formula C16H21FO3 and a molecular weight of 280.34 g/mol. Its IUPAC name is 3-[(4,7-dimethyl-6-oxo-2,4a,5,8a-tetrahydrochromen-2-yl)methyl]but-3-enyl hypofluorite.
| Compound Name | 3-[(4,7-dimethyl-6-oxo-2,4a,5,8a-tetrahydrochromen-2-yl)methyl]but-3-enyl hypofluorite |
|---|---|
| PubChem CID | 169186239 |
| Molecular Formula | C16H21FO3 |
| Molecular Weight | 280.34 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | 3-[(4,7-dimethyl-6-oxo-2,4a,5,8a-tetrahydrochromen-2-yl)methyl]but-3-enyl hypofluorite |
| SMILES | C=C(CCOF)CC1C=C(C)C2CC(=O)C(C)=CC2O1 |
| InChI | InChI=1S/C16H21FO3/c1-10(4-5-19-17)6-13-7-11(2)14-9-15(18)12(3)8-16(14)20-13/h7-8,13-14,16H,1,4-6,9H2,2-3H3 |
| InChIKey | DKUFKEORBZFURO-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.34 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|