C27H44O4 — CID 169186236
2,6-dimethylhepta-1,6-diene;ethane;4-(hydroxymethyl)-2-(4-hydroxy-2-methylidenebutyl)-7-methyl-2,4a,5,8a-tetrahydrochromen-6-one (PubChem CID 169186236) has the molecular formula C27H44O4 and a molecular weight of 432.65 g/mol. Its IUPAC name is 2,6-dimethylhepta-1,6-diene;ethane;4-(hydroxymethyl)-2-(4-hydroxy-2-methylidenebutyl)-7-methyl-2,4a,5,8a-tetrahydrochromen-6-one.
| Compound Name | 2,6-dimethylhepta-1,6-diene;ethane;4-(hydroxymethyl)-2-(4-hydroxy-2-methylidenebutyl)-7-methyl-2,4a,5,8a-tetrahydrochromen-6-one |
|---|---|
| PubChem CID | 169186236 |
| Molecular Formula | C27H44O4 |
| Molecular Weight | 432.65 g/mol |
| Exact Mass | 432.32 |
| IUPAC Name | 2,6-dimethylhepta-1,6-diene;ethane;4-(hydroxymethyl)-2-(4-hydroxy-2-methylidenebutyl)-7-methyl-2,4a,5,8a-tetrahydrochromen-6-one |
| SMILES | C=C(C)CCCC(=C)C.C=C(CCO)CC1C=C(CO)C2CC(=O)C(C)=CC2O1.CC |
| InChI | InChI=1S/C16H22O4.C9H16.C2H6/c1-10(3-4-17)5-13-7-12(9-18)14-8-15(19)11(2)6-16(14)20-13;1-8(2)6-5-7-9(3)4;1-2/h6-7,13-14,16-18H,1,3-5,8-9H2,2H3;1,3,5-7H2,2,4H3;1-2H3 |
| InChIKey | MZZVXWCPMHSOKT-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.65 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|