C15H21FO4 — CID 169186252
4-[4-(hydroxymethyl)-7-methyl-6-oxo-2,4a,5,8a-tetrahydrochromen-2-yl]butyl hypofluorite (PubChem CID 169186252) has the molecular formula C15H21FO4 and a molecular weight of 284.33 g/mol. Its IUPAC name is 4-[4-(hydroxymethyl)-7-methyl-6-oxo-2,4a,5,8a-tetrahydrochromen-2-yl]butyl hypofluorite.
| Compound Name | 4-[4-(hydroxymethyl)-7-methyl-6-oxo-2,4a,5,8a-tetrahydrochromen-2-yl]butyl hypofluorite |
|---|---|
| PubChem CID | 169186252 |
| Molecular Formula | C15H21FO4 |
| Molecular Weight | 284.33 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | 4-[4-(hydroxymethyl)-7-methyl-6-oxo-2,4a,5,8a-tetrahydrochromen-2-yl]butyl hypofluorite |
| SMILES | CC1=CC2OC(CCCCOF)C=C(CO)C2CC1=O |
| InChI | InChI=1S/C15H21FO4/c1-10-6-15-13(8-14(10)18)11(9-17)7-12(20-15)4-2-3-5-19-16/h6-7,12-13,15,17H,2-5,8-9H2,1H3 |
| InChIKey | YDKXZZNQTWNCPA-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.33 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|