C30H44O6 — CID 73442964
[(2S,4'R,4aR,6'S,8aR)-6'-[(1E)-2,6-dimethylhepta-1,6-dienyl]-4-(hydroxymethyl)-4',7-dimethyl-6-oxospiro[5,8a-dihydro-4aH-chromene-2,2'-oxane]-4'-yl] 3-methylbutanoate (PubChem CID 73442964) has the molecular formula C30H44O6 and a molecular weight of 500.68 g/mol. Its IUPAC name is [(2S,4'R,4aR,6'S,8aR)-6'-[(1E)-2,6-dimethylhepta-1,6-dienyl]-4-(hydroxymethyl)-4',7-dimethyl-6-oxospiro[5,8a-dihydro-4aH-chromene-2,2'-oxane]-4'-yl] 3-methylbutanoate.
| Compound Name | [(2S,4'R,4aR,6'S,8aR)-6'-[(1E)-2,6-dimethylhepta-1,6-dienyl]-4-(hydroxymethyl)-4',7-dimethyl-6-oxospiro[5,8a-dihydro-4aH-chromene-2,2'-oxane]-4'-yl] 3-methylbutanoate |
|---|---|
| PubChem CID | 73442964 |
| Molecular Formula | C30H44O6 |
| Molecular Weight | 500.68 g/mol |
| Exact Mass | 500.31 |
| IUPAC Name | [(2S,4'R,4aR,6'S,8aR)-6'-[(1E)-2,6-dimethylhepta-1,6-dienyl]-4-(hydroxymethyl)-4',7-dimethyl-6-oxospiro[5,8a-dihydro-4aH-chromene-2,2'-oxane]-4'-yl] 3-methylbutanoate |
| SMILES | C=C(C)CCC/C(C)=C/[C@@H]1C[C@@](C)(OC(=O)CC(C)C)C[C@]2(C=C(CO)[C@H]3CC(=O)C(C)=C[C@H]3O2)O1 |
| InChI | InChI=1S/C30H44O6/c1-19(2)9-8-10-21(5)12-24-16-29(7,36-28(33)11-20(3)4)18-30(34-24)15-23(17-31)25-14-26(32)22(6)13-27(25)35-30/h12-13,15,20,24-25,27,31H,1,8-11,14,16-18H2,2-7H3/b21-12+/t24-,25-,27-,29-,30-/m1/s1 |
| InChIKey | WNAYBGQHONDZGG-ZBYLALFYSA-N |
| XLogP | 5.76 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.68 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|