C20H30O3 — CID 143984467
(2R)-4,7-dimethyl-2-(5-methylhexa-1,5-dien-3-yloxy)-2,4a,5,8a-tetrahydrochromen-6-one;ethane (PubChem CID 143984467) has the molecular formula C20H30O3 and a molecular weight of 318.46 g/mol. Its IUPAC name is (2R)-4,7-dimethyl-2-(5-methylhexa-1,5-dien-3-yloxy)-2,4a,5,8a-tetrahydrochromen-6-one;ethane.
| Compound Name | (2R)-4,7-dimethyl-2-(5-methylhexa-1,5-dien-3-yloxy)-2,4a,5,8a-tetrahydrochromen-6-one;ethane |
|---|---|
| PubChem CID | 143984467 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | (2R)-4,7-dimethyl-2-(5-methylhexa-1,5-dien-3-yloxy)-2,4a,5,8a-tetrahydrochromen-6-one;ethane |
| SMILES | C=CC(CC(=C)C)O[C@H]1C=C(C)C2CC(=O)C(C)=CC2O1.CC |
| InChI | InChI=1S/C18H24O3.C2H6/c1-6-14(7-11(2)3)20-18-9-12(4)15-10-16(19)13(5)8-17(15)21-18;1-2/h6,8-9,14-15,17-18H,1-2,7,10H2,3-5H3;1-2H3/t14?,15?,17?,18-;/m1./s1 |
| InChIKey | PCSNMPCHMGQTMZ-MEONDOOASA-N |
| XLogP | 4.76 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|