C25H33FO3 — CID 123776414
(2S,4'aR,6S,8'aR)-2-(2,6-dimethylhepta-1,5-dienyl)-4'-(fluoromethyl)-4,7'-dimethylspiro[2,3-dihydropyran-6,2'-5,8a-dihydro-4aH-chromene]-6'-one (PubChem CID 123776414) has the molecular formula C25H33FO3 and a molecular weight of 400.53 g/mol. Its IUPAC name is (2S,4'aR,6S,8'aR)-2-(2,6-dimethylhepta-1,5-dienyl)-4'-(fluoromethyl)-4,7'-dimethylspiro[2,3-dihydropyran-6,2'-5,8a-dihydro-4aH-chromene]-6'-one.
| Compound Name | (2S,4'aR,6S,8'aR)-2-(2,6-dimethylhepta-1,5-dienyl)-4'-(fluoromethyl)-4,7'-dimethylspiro[2,3-dihydropyran-6,2'-5,8a-dihydro-4aH-chromene]-6'-one |
|---|---|
| PubChem CID | 123776414 |
| Molecular Formula | C25H33FO3 |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.24 |
| IUPAC Name | (2S,4'aR,6S,8'aR)-2-(2,6-dimethylhepta-1,5-dienyl)-4'-(fluoromethyl)-4,7'-dimethylspiro[2,3-dihydropyran-6,2'-5,8a-dihydro-4aH-chromene]-6'-one |
| SMILES | CC(C)=CCCC(C)=C[C@@H]1CC(C)=C[C@]2(C=C(CF)[C@H]3CC(=O)C(C)=C[C@H]3O2)O1 |
| InChI | InChI=1S/C25H33FO3/c1-16(2)7-6-8-17(3)9-21-10-18(4)13-25(28-21)14-20(15-26)22-12-23(27)19(5)11-24(22)29-25/h7,9,11,13-14,21-22,24H,6,8,10,12,15H2,1-5H3/t21-,22-,24-,25+/m1/s1 |
| InChIKey | LISGZTVGWVSMGL-MFYODDQASA-N |
| XLogP | 5.94 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|