C27H48O3 — CID 169186241
2,6-dimethyloct-2-ene;ethane;2-(4-hydroxybutyl)-4,7-dimethyl-2,4a,5,8a-tetrahydrochromen-6-one (PubChem CID 169186241) has the molecular formula C27H48O3 and a molecular weight of 420.68 g/mol. Its IUPAC name is 2,6-dimethyloct-2-ene;ethane;2-(4-hydroxybutyl)-4,7-dimethyl-2,4a,5,8a-tetrahydrochromen-6-one.
| Compound Name | 2,6-dimethyloct-2-ene;ethane;2-(4-hydroxybutyl)-4,7-dimethyl-2,4a,5,8a-tetrahydrochromen-6-one |
|---|---|
| PubChem CID | 169186241 |
| Molecular Formula | C27H48O3 |
| Molecular Weight | 420.68 g/mol |
| Exact Mass | 420.36 |
| IUPAC Name | 2,6-dimethyloct-2-ene;ethane;2-(4-hydroxybutyl)-4,7-dimethyl-2,4a,5,8a-tetrahydrochromen-6-one |
| SMILES | CC.CC1=CC2OC(CCCCO)C=C(C)C2CC1=O.CCC(C)CCC=C(C)C |
| InChI | InChI=1S/C15H22O3.C10H20.C2H6/c1-10-7-12(5-3-4-6-16)18-15-8-11(2)14(17)9-13(10)15;1-5-10(4)8-6-7-9(2)3;1-2/h7-8,12-13,15-16H,3-6,9H2,1-2H3;7,10H,5-6,8H2,1-4H3;1-2H3 |
| InChIKey | UVGRTDVZTVXHNX-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.68 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|