C27H43FO3 — CID 169186238
2,6-dimethylhepta-1,6-diene;3-[(4,7-dimethyl-6-oxo-2,4a,5,8a-tetrahydrochromen-2-yl)methyl]but-3-enyl hypofluorite;ethane (PubChem CID 169186238) has the molecular formula C27H43FO3 and a molecular weight of 434.64 g/mol. Its IUPAC name is 2,6-dimethylhepta-1,6-diene;3-[(4,7-dimethyl-6-oxo-2,4a,5,8a-tetrahydrochromen-2-yl)methyl]but-3-enyl hypofluorite;ethane.
| Compound Name | 2,6-dimethylhepta-1,6-diene;3-[(4,7-dimethyl-6-oxo-2,4a,5,8a-tetrahydrochromen-2-yl)methyl]but-3-enyl hypofluorite;ethane |
|---|---|
| PubChem CID | 169186238 |
| Molecular Formula | C27H43FO3 |
| Molecular Weight | 434.64 g/mol |
| Exact Mass | 434.32 |
| IUPAC Name | 2,6-dimethylhepta-1,6-diene;3-[(4,7-dimethyl-6-oxo-2,4a,5,8a-tetrahydrochromen-2-yl)methyl]but-3-enyl hypofluorite;ethane |
| SMILES | C=C(C)CCCC(=C)C.C=C(CCOF)CC1C=C(C)C2CC(=O)C(C)=CC2O1.CC |
| InChI | InChI=1S/C16H21FO3.C9H16.C2H6/c1-10(4-5-19-17)6-13-7-11(2)14-9-15(18)12(3)8-16(14)20-13;1-8(2)6-5-7-9(3)4;1-2/h7-8,13-14,16H,1,4-6,9H2,2-3H3;1,3,5-7H2,2,4H3;1-2H3 |
| InChIKey | OMKMPGIYZWKUMC-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.64 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|