C21H33FO3 — CID 118018312
1-[(3S,5R)-5-ethoxy-4-[(4R)-4-fluorocyclohexen-1-yl]-3-propoxycyclohexen-1-yl]butan-1-one (PubChem CID 118018312) has the molecular formula C21H33FO3 and a molecular weight of 352.49 g/mol. Its IUPAC name is 1-[(3S,5R)-5-ethoxy-4-[(4R)-4-fluorocyclohexen-1-yl]-3-propoxycyclohexen-1-yl]butan-1-one.
| Compound Name | 1-[(3S,5R)-5-ethoxy-4-[(4R)-4-fluorocyclohexen-1-yl]-3-propoxycyclohexen-1-yl]butan-1-one |
|---|---|
| PubChem CID | 118018312 |
| Molecular Formula | C21H33FO3 |
| Molecular Weight | 352.49 g/mol |
| Exact Mass | 352.24 |
| IUPAC Name | 1-[(3S,5R)-5-ethoxy-4-[(4R)-4-fluorocyclohexen-1-yl]-3-propoxycyclohexen-1-yl]butan-1-one |
| SMILES | CCCO[C@H]1C=C(C(=O)CCC)C[C@@H](OCC)C1C1=CC[C@H](F)CC1 |
| InChI | InChI=1S/C21H33FO3/c1-4-7-18(23)16-13-19(24-6-3)21(20(14-16)25-12-5-2)15-8-10-17(22)11-9-15/h8,14,17,19-21H,4-7,9-13H2,1-3H3/t17-,19+,20-,21?/m0/s1 |
| InChIKey | KAMDJFAHZOOWID-NHNNTYDRSA-N |
| XLogP | 4.95 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.49 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|