C17H25FO3 — CID 118018304
(4R,5R)-3,5-diethoxy-4-[(4R)-4-fluorocyclohexen-1-yl]cyclohexene-1-carbaldehyde (PubChem CID 118018304) has the molecular formula C17H25FO3 and a molecular weight of 296.38 g/mol. Its IUPAC name is (4R,5R)-3,5-diethoxy-4-[(4R)-4-fluorocyclohexen-1-yl]cyclohexene-1-carbaldehyde.
| Compound Name | (4R,5R)-3,5-diethoxy-4-[(4R)-4-fluorocyclohexen-1-yl]cyclohexene-1-carbaldehyde |
|---|---|
| PubChem CID | 118018304 |
| Molecular Formula | C17H25FO3 |
| Molecular Weight | 296.38 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | (4R,5R)-3,5-diethoxy-4-[(4R)-4-fluorocyclohexen-1-yl]cyclohexene-1-carbaldehyde |
| SMILES | CCOC1C=C(C=O)C[C@@H](OCC)[C@H]1C1=CC[C@H](F)CC1 |
| InChI | InChI=1S/C17H25FO3/c1-3-20-15-9-12(11-19)10-16(21-4-2)17(15)13-5-7-14(18)8-6-13/h5,9,11,14-17H,3-4,6-8,10H2,1-2H3/t14-,15?,16+,17-/m0/s1 |
| InChIKey | BNDKUCWVERSARU-CYBCNJLJSA-N |
| XLogP | 3.39 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.38 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|