C10H18F2N2O2 — CID 123616080
methyl 2-amino-5-cyclopropyl-4,4-difluoro-2-(methylamino)pentanoate (PubChem CID 123616080) has the molecular formula C10H18F2N2O2 and a molecular weight of 236.26 g/mol. Its IUPAC name is methyl 2-amino-5-cyclopropyl-4,4-difluoro-2-(methylamino)pentanoate.
| Compound Name | methyl 2-amino-5-cyclopropyl-4,4-difluoro-2-(methylamino)pentanoate |
|---|---|
| PubChem CID | 123616080 |
| Molecular Formula | C10H18F2N2O2 |
| Molecular Weight | 236.26 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | methyl 2-amino-5-cyclopropyl-4,4-difluoro-2-(methylamino)pentanoate |
| SMILES | CNC(N)(CC(F)(F)CC1CC1)C(=O)OC |
| InChI | InChI=1S/C10H18F2N2O2/c1-14-10(13,8(15)16-2)6-9(11,12)5-7-3-4-7/h7,14H,3-6,13H2,1-2H3 |
| InChIKey | SJAXKCKGZKKTNK-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.26 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|