C7H14N2O — CID 123617152
2-amino-N-propylbut-3-enamide (PubChem CID 123617152) has the molecular formula C7H14N2O and a molecular weight of 142.20 g/mol. Its IUPAC name is 2-amino-N-propylbut-3-enamide.
| Compound Name | 2-amino-N-propylbut-3-enamide |
|---|---|
| PubChem CID | 123617152 |
| Molecular Formula | C7H14N2O |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.11 |
| IUPAC Name | 2-amino-N-propylbut-3-enamide |
| SMILES | C=CC(N)C(=O)NCCC |
| InChI | InChI=1S/C7H14N2O/c1-3-5-9-7(10)6(8)4-2/h4,6H,2-3,5,8H2,1H3,(H,9,10) |
| InChIKey | JTOACHLAAKXGTQ-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|