C8H14F2N2O — CID 115406814
2-(2,2-difluoroethylamino)-N-prop-2-enylpropanamide (PubChem CID 115406814) has the molecular formula C8H14F2N2O and a molecular weight of 192.21 g/mol. Its IUPAC name is 2-(2,2-difluoroethylamino)-N-prop-2-enylpropanamide.
| Compound Name | 2-(2,2-difluoroethylamino)-N-prop-2-enylpropanamide |
|---|---|
| PubChem CID | 115406814 |
| Molecular Formula | C8H14F2N2O |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.11 |
| IUPAC Name | 2-(2,2-difluoroethylamino)-N-prop-2-enylpropanamide |
| SMILES | C=CCNC(=O)C(C)NCC(F)F |
| InChI | InChI=1S/C8H14F2N2O/c1-3-4-11-8(13)6(2)12-5-7(9)10/h3,6-7,12H,1,4-5H2,2H3,(H,11,13) |
| InChIKey | JGHUHXSISRCYKY-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|