C23H30N6O4 — CID 123618108
[4-[[3-(aminomethoxymethyl)cyclopentyl]amino]pyrimidin-5-yl]-[1-[3-(4-hydroxyoxan-4-yl)prop-2-ynyl]pyrazol-3-yl]methanone (PubChem CID 123618108) has the molecular formula C23H30N6O4 and a molecular weight of 454.53 g/mol. Its IUPAC name is [4-[[3-(aminomethoxymethyl)cyclopentyl]amino]pyrimidin-5-yl]-[1-[3-(4-hydroxyoxan-4-yl)prop-2-ynyl]pyrazol-3-yl]methanone.
| Compound Name | [4-[[3-(aminomethoxymethyl)cyclopentyl]amino]pyrimidin-5-yl]-[1-[3-(4-hydroxyoxan-4-yl)prop-2-ynyl]pyrazol-3-yl]methanone |
|---|---|
| PubChem CID | 123618108 |
| Molecular Formula | C23H30N6O4 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.23 |
| IUPAC Name | [4-[[3-(aminomethoxymethyl)cyclopentyl]amino]pyrimidin-5-yl]-[1-[3-(4-hydroxyoxan-4-yl)prop-2-ynyl]pyrazol-3-yl]methanone |
| SMILES | NCOCC1CCC(Nc2ncncc2C(=O)c2ccn(CC#CC3(O)CCOCC3)n2)C1 |
| InChI | InChI=1S/C23H30N6O4/c24-15-33-14-17-2-3-18(12-17)27-22-19(13-25-16-26-22)21(30)20-4-9-29(28-20)8-1-5-23(31)6-10-32-11-7-23/h4,9,13,16-18,31H,2-3,6-8,10-12,14-15,24H2,(H,25,26,27) |
| InChIKey | DBBUFLVGGQRLEQ-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 137.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|