C25H30N2 — CID 123618498
9-tert-butyl-17,17-diethyl-1,8-diazapentacyclo[9.6.2.02,7.08,18.015,19]nonadeca-2,4,6,9,11,13,15(19)-heptaene (PubChem CID 123618498) has the molecular formula C25H30N2 and a molecular weight of 358.53 g/mol. Its IUPAC name is 9-tert-butyl-17,17-diethyl-1,8-diazapentacyclo[9.6.2.02,7.08,18.015,19]nonadeca-2,4,6,9,11,13,15(19)-heptaene.
| Compound Name | 9-tert-butyl-17,17-diethyl-1,8-diazapentacyclo[9.6.2.02,7.08,18.015,19]nonadeca-2,4,6,9,11,13,15(19)-heptaene |
|---|---|
| PubChem CID | 123618498 |
| Molecular Formula | C25H30N2 |
| Molecular Weight | 358.53 g/mol |
| Exact Mass | 358.24 |
| IUPAC Name | 9-tert-butyl-17,17-diethyl-1,8-diazapentacyclo[9.6.2.02,7.08,18.015,19]nonadeca-2,4,6,9,11,13,15(19)-heptaene |
| SMILES | CCC1(CC)Cc2cccc3c2C2N(C(C(C)(C)C)=C3)c3ccccc3N21 |
| InChI | InChI=1S/C25H30N2/c1-6-25(7-2)16-18-12-10-11-17-15-21(24(3,4)5)26-19-13-8-9-14-20(19)27(25)23(26)22(17)18/h8-15,23H,6-7,16H2,1-5H3 |
| InChIKey | LKZGATQFCYTFLE-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.53 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |