C14H30O2S — CID 123619579
3-(trimethyl-λ4-sulfanyl)propyl 2,4,4-trimethylpentanoate (PubChem CID 123619579) has the molecular formula C14H30O2S and a molecular weight of 262.46 g/mol. Its IUPAC name is 3-(trimethyl-λ4-sulfanyl)propyl 2,4,4-trimethylpentanoate.
| Compound Name | 3-(trimethyl-λ4-sulfanyl)propyl 2,4,4-trimethylpentanoate |
|---|---|
| PubChem CID | 123619579 |
| Molecular Formula | C14H30O2S |
| Molecular Weight | 262.46 g/mol |
| Exact Mass | 262.20 |
| IUPAC Name | 3-(trimethyl-λ4-sulfanyl)propyl 2,4,4-trimethylpentanoate |
| SMILES | CC(CC(C)(C)C)C(=O)OCCCS(C)(C)C |
| InChI | InChI=1S/C14H30O2S/c1-12(11-14(2,3)4)13(15)16-9-8-10-17(5,6)7/h12H,8-11H2,1-7H3 |
| InChIKey | ZFYWZBQKGVMCGH-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.46 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|