C8H14O2S — CID 132551218
3,3-dimethyl-5-(methylsulfanylmethyl)oxolan-2-one (PubChem CID 132551218) has the molecular formula C8H14O2S and a molecular weight of 174.26 g/mol. Its IUPAC name is 3,3-dimethyl-5-(methylsulfanylmethyl)oxolan-2-one.
| Compound Name | 3,3-dimethyl-5-(methylsulfanylmethyl)oxolan-2-one |
|---|---|
| PubChem CID | 132551218 |
| Molecular Formula | C8H14O2S |
| Molecular Weight | 174.26 g/mol |
| Exact Mass | 174.07 |
| IUPAC Name | 3,3-dimethyl-5-(methylsulfanylmethyl)oxolan-2-one |
| SMILES | CSCC1CC(C)(C)C(=O)O1 |
| InChI | InChI=1S/C8H14O2S/c1-8(2)4-6(5-11-3)10-7(8)9/h6H,4-5H2,1-3H3 |
| InChIKey | KONADKYSXQTAEE-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.26 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |