C13H16F2N2O2 — CID 123621507
[(3S,4R)-4-(3,4-difluorophenyl)pyrrolidin-3-yl]-ethylcarbamic acid (PubChem CID 123621507) has the molecular formula C13H16F2N2O2 and a molecular weight of 270.28 g/mol. Its IUPAC name is [(3S,4R)-4-(3,4-difluorophenyl)pyrrolidin-3-yl]-ethylcarbamic acid.
| Compound Name | [(3S,4R)-4-(3,4-difluorophenyl)pyrrolidin-3-yl]-ethylcarbamic acid |
|---|---|
| PubChem CID | 123621507 |
| Molecular Formula | C13H16F2N2O2 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | [(3S,4R)-4-(3,4-difluorophenyl)pyrrolidin-3-yl]-ethylcarbamic acid |
| SMILES | CCN(C(=O)O)[C@@H]1CNC[C@H]1c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C13H16F2N2O2/c1-2-17(13(18)19)12-7-16-6-9(12)8-3-4-10(14)11(15)5-8/h3-5,9,12,16H,2,6-7H2,1H3,(H,18,19)/t9-,12+/m0/s1 |
| InChIKey | HWTFZRVNQKHQFS-JOYOIKCWSA-N |
| XLogP | 2.02 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |