C17H18F2N2 — CID 67249530
(3S,4R)-N-benzyl-4-(3,4-difluorophenyl)pyrrolidin-3-amine (PubChem CID 67249530) has the molecular formula C17H18F2N2 and a molecular weight of 288.34 g/mol. Its IUPAC name is (3S,4R)-N-benzyl-4-(3,4-difluorophenyl)pyrrolidin-3-amine.
| Compound Name | (3S,4R)-N-benzyl-4-(3,4-difluorophenyl)pyrrolidin-3-amine |
|---|---|
| PubChem CID | 67249530 |
| Molecular Formula | C17H18F2N2 |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | (3S,4R)-N-benzyl-4-(3,4-difluorophenyl)pyrrolidin-3-amine |
| SMILES | Fc1ccc([C@@H]2CNC[C@H]2NCc2ccccc2)cc1F |
| InChI | InChI=1S/C17H18F2N2/c18-15-7-6-13(8-16(15)19)14-10-20-11-17(14)21-9-12-4-2-1-3-5-12/h1-8,14,17,20-21H,9-11H2/t14-,17+/m0/s1 |
| InChIKey | NIDMHTYRCHNPQN-WMLDXEAASA-N |
| XLogP | 2.81 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |