C16H16FN — CID 90204582
N-benzyl-2-(4-fluorophenyl)cyclopropan-1-amine (PubChem CID 90204582) has the molecular formula C16H16FN and a molecular weight of 241.31 g/mol. Its IUPAC name is N-benzyl-2-(4-fluorophenyl)cyclopropan-1-amine.
| Compound Name | N-benzyl-2-(4-fluorophenyl)cyclopropan-1-amine |
|---|---|
| PubChem CID | 90204582 |
| Molecular Formula | C16H16FN |
| Molecular Weight | 241.31 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | N-benzyl-2-(4-fluorophenyl)cyclopropan-1-amine |
| SMILES | Fc1ccc(C2CC2NCc2ccccc2)cc1 |
| InChI | InChI=1S/C16H16FN/c17-14-8-6-13(7-9-14)15-10-16(15)18-11-12-4-2-1-3-5-12/h1-9,15-16,18H,10-11H2 |
| InChIKey | UJQIUNUAVOWVOY-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.31 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |