C23H26F2N2O2 — CID 175748356
benzyl 2-fluoro-4-[[[(1R,2S)-2-(4-fluorophenyl)cyclopropyl]amino]methyl]piperidine-1-carboxylate (PubChem CID 175748356) has the molecular formula C23H26F2N2O2 and a molecular weight of 400.47 g/mol. Its IUPAC name is benzyl 2-fluoro-4-[[[(1R,2S)-2-(4-fluorophenyl)cyclopropyl]amino]methyl]piperidine-1-carboxylate.
| Compound Name | benzyl 2-fluoro-4-[[[(1R,2S)-2-(4-fluorophenyl)cyclopropyl]amino]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 175748356 |
| Molecular Formula | C23H26F2N2O2 |
| Molecular Weight | 400.47 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | benzyl 2-fluoro-4-[[[(1R,2S)-2-(4-fluorophenyl)cyclopropyl]amino]methyl]piperidine-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CCC(CN[C@@H]2C[C@H]2c2ccc(F)cc2)CC1F |
| InChI | InChI=1S/C23H26F2N2O2/c24-19-8-6-18(7-9-19)20-13-21(20)26-14-17-10-11-27(22(25)12-17)23(28)29-15-16-4-2-1-3-5-16/h1-9,17,20-22,26H,10-15H2/t17?,20-,21+,22?/m0/s1 |
| InChIKey | PCZVZPBRRLSRPB-IXRUWLOTSA-N |
| XLogP | 4.62 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.47 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|