C25H29FN2O3 — CID 175748336
benzyl 4-[[[(1R,2S)-2-(2,3-dihydro-1-benzofuran-5-yl)cyclopropyl]amino]methyl]-2-fluoropiperidine-1-carboxylate (PubChem CID 175748336) has the molecular formula C25H29FN2O3 and a molecular weight of 424.52 g/mol. Its IUPAC name is benzyl 4-[[[(1R,2S)-2-(2,3-dihydro-1-benzofuran-5-yl)cyclopropyl]amino]methyl]-2-fluoropiperidine-1-carboxylate.
| Compound Name | benzyl 4-[[[(1R,2S)-2-(2,3-dihydro-1-benzofuran-5-yl)cyclopropyl]amino]methyl]-2-fluoropiperidine-1-carboxylate |
|---|---|
| PubChem CID | 175748336 |
| Molecular Formula | C25H29FN2O3 |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | benzyl 4-[[[(1R,2S)-2-(2,3-dihydro-1-benzofuran-5-yl)cyclopropyl]amino]methyl]-2-fluoropiperidine-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CCC(CN[C@@H]2C[C@H]2c2ccc3c(c2)CCO3)CC1F |
| InChI | InChI=1S/C25H29FN2O3/c26-24-12-18(8-10-28(24)25(29)31-16-17-4-2-1-3-5-17)15-27-22-14-21(22)19-6-7-23-20(13-19)9-11-30-23/h1-7,13,18,21-22,24,27H,8-12,14-16H2/t18?,21-,22+,24?/m0/s1 |
| InChIKey | WJLMJKYNYPXKBJ-JSXGBRPTSA-N |
| XLogP | 4.41 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|