C26H30FN3O2 — CID 175748307
benzyl 2-fluoro-4-[[[(1R,2S)-2-(1-methylindol-5-yl)cyclopropyl]amino]methyl]piperidine-1-carboxylate (PubChem CID 175748307) has the molecular formula C26H30FN3O2 and a molecular weight of 435.54 g/mol. Its IUPAC name is benzyl 2-fluoro-4-[[[(1R,2S)-2-(1-methylindol-5-yl)cyclopropyl]amino]methyl]piperidine-1-carboxylate.
| Compound Name | benzyl 2-fluoro-4-[[[(1R,2S)-2-(1-methylindol-5-yl)cyclopropyl]amino]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 175748307 |
| Molecular Formula | C26H30FN3O2 |
| Molecular Weight | 435.54 g/mol |
| Exact Mass | 435.23 |
| IUPAC Name | benzyl 2-fluoro-4-[[[(1R,2S)-2-(1-methylindol-5-yl)cyclopropyl]amino]methyl]piperidine-1-carboxylate |
| SMILES | Cn1ccc2cc([C@@H]3C[C@H]3NCC3CCN(C(=O)OCc4ccccc4)C(F)C3)ccc21 |
| InChI | InChI=1S/C26H30FN3O2/c1-29-11-10-21-14-20(7-8-24(21)29)22-15-23(22)28-16-19-9-12-30(25(27)13-19)26(31)32-17-18-5-3-2-4-6-18/h2-8,10-11,14,19,22-23,25,28H,9,12-13,15-17H2,1H3/t19?,22-,23+,25?/m0/s1 |
| InChIKey | UFGVTDUCXZRNNT-TUFFRXEWSA-N |
| XLogP | 4.97 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.54 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|