C25H31FN2O2 — CID 175748352
benzyl 2-fluoro-2,6-dimethyl-4-[[[(1R,2S)-2-phenylcyclopropyl]amino]methyl]piperidine-1-carboxylate (PubChem CID 175748352) has the molecular formula C25H31FN2O2 and a molecular weight of 410.53 g/mol. Its IUPAC name is benzyl 2-fluoro-2,6-dimethyl-4-[[[(1R,2S)-2-phenylcyclopropyl]amino]methyl]piperidine-1-carboxylate.
| Compound Name | benzyl 2-fluoro-2,6-dimethyl-4-[[[(1R,2S)-2-phenylcyclopropyl]amino]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 175748352 |
| Molecular Formula | C25H31FN2O2 |
| Molecular Weight | 410.53 g/mol |
| Exact Mass | 410.24 |
| IUPAC Name | benzyl 2-fluoro-2,6-dimethyl-4-[[[(1R,2S)-2-phenylcyclopropyl]amino]methyl]piperidine-1-carboxylate |
| SMILES | CC1CC(CN[C@@H]2C[C@H]2c2ccccc2)CC(C)(F)N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C25H31FN2O2/c1-18-13-20(16-27-23-14-22(23)21-11-7-4-8-12-21)15-25(2,26)28(18)24(29)30-17-19-9-5-3-6-10-19/h3-12,18,20,22-23,27H,13-17H2,1-2H3/t18?,20?,22-,23+,25?/m0/s1 |
| InChIKey | IKKQASFRZGBIID-RTCJNNSLSA-N |
| XLogP | 5.26 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.53 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|