C17H17F3N2 — CID 123156014
(3R,4S)-N-benzyl-4-(2,4,5-trifluorophenyl)pyrrolidin-3-amine (PubChem CID 123156014) has the molecular formula C17H17F3N2 and a molecular weight of 306.33 g/mol. Its IUPAC name is (3R,4S)-N-benzyl-4-(2,4,5-trifluorophenyl)pyrrolidin-3-amine.
| Compound Name | (3R,4S)-N-benzyl-4-(2,4,5-trifluorophenyl)pyrrolidin-3-amine |
|---|---|
| PubChem CID | 123156014 |
| Molecular Formula | C17H17F3N2 |
| Molecular Weight | 306.33 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | (3R,4S)-N-benzyl-4-(2,4,5-trifluorophenyl)pyrrolidin-3-amine |
| SMILES | Fc1cc(F)c([C@H]2CNC[C@@H]2NCc2ccccc2)cc1F |
| InChI | InChI=1S/C17H17F3N2/c18-14-7-16(20)15(19)6-12(14)13-9-21-10-17(13)22-8-11-4-2-1-3-5-11/h1-7,13,17,21-22H,8-10H2/t13-,17+/m1/s1 |
| InChIKey | JKOWCXVJPFNDRX-DYVFJYSZSA-N |
| XLogP | 2.95 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.33 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|