C7H8F3N — CID 123621624
(3E)-4-(trifluoromethyl)hexa-3,5-dien-2-imine (PubChem CID 123621624) has the molecular formula C7H8F3N and a molecular weight of 163.14 g/mol. Its IUPAC name is (3E)-4-(trifluoromethyl)hexa-3,5-dien-2-imine.
| Compound Name | (3E)-4-(trifluoromethyl)hexa-3,5-dien-2-imine |
|---|---|
| PubChem CID | 123621624 |
| Molecular Formula | C7H8F3N |
| Molecular Weight | 163.14 g/mol |
| Exact Mass | 163.06 |
| IUPAC Name | (3E)-4-(trifluoromethyl)hexa-3,5-dien-2-imine |
| SMILES | [H]/N=C(C)/C=C(\C=C)C(F)(F)F |
| InChI | InChI=1S/C7H8F3N/c1-3-6(4-5(2)11)7(8,9)10/h3-4,11H,1H2,2H3/b6-4+,11-5+ |
| InChIKey | VCAGKXGTAYHYHO-KGUOMNFLSA-N |
| XLogP | 2.70 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.14 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|