C23H28ClN7OS2 — CID 123621799
[4-(2-chloro-4-hydrazinyl-5-sulfanylanilino)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]-[3-(dimethylamino)pyrrolidin-1-yl]methanone (PubChem CID 123621799) has the molecular formula C23H28ClN7OS2 and a molecular weight of 518.11 g/mol. Its IUPAC name is [4-(2-chloro-4-hydrazinyl-5-sulfanylanilino)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]-[3-(dimethylamino)pyrrolidin-1-yl]methanone.
| Compound Name | [4-(2-chloro-4-hydrazinyl-5-sulfanylanilino)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]-[3-(dimethylamino)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 123621799 |
| Molecular Formula | C23H28ClN7OS2 |
| Molecular Weight | 518.11 g/mol |
| Exact Mass | 517.15 |
| IUPAC Name | [4-(2-chloro-4-hydrazinyl-5-sulfanylanilino)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]-[3-(dimethylamino)pyrrolidin-1-yl]methanone |
| SMILES | CN(C)C1CCN(C(=O)C2CCc3c(sc4ncnc(Nc5cc(S)c(NN)cc5Cl)c34)C2)C1 |
| InChI | InChI=1S/C23H28ClN7OS2/c1-30(2)13-5-6-31(10-13)23(32)12-3-4-14-19(7-12)34-22-20(14)21(26-11-27-22)28-16-9-18(33)17(29-25)8-15(16)24/h8-9,11-13,29,33H,3-7,10,25H2,1-2H3,(H,26,27,28) |
| InChIKey | GMWWLQSKNHPOIX-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 99.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.11 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|