C19H36O4Si2 — CID 123624034
[3-[methyl(trimethylsilyloxy)silyl]-5-(7-oxabicyclo[4.1.0]heptan-3-yl)pentyl] 2-methylprop-2-enoate (PubChem CID 123624034) has the molecular formula C19H36O4Si2 and a molecular weight of 384.67 g/mol. Its IUPAC name is [3-[methyl(trimethylsilyloxy)silyl]-5-(7-oxabicyclo[4.1.0]heptan-3-yl)pentyl] 2-methylprop-2-enoate.
| Compound Name | [3-[methyl(trimethylsilyloxy)silyl]-5-(7-oxabicyclo[4.1.0]heptan-3-yl)pentyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 123624034 |
| Molecular Formula | C19H36O4Si2 |
| Molecular Weight | 384.67 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | [3-[methyl(trimethylsilyloxy)silyl]-5-(7-oxabicyclo[4.1.0]heptan-3-yl)pentyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC(CCC1CCC2OC2C1)[SiH](C)O[Si](C)(C)C |
| InChI | InChI=1S/C19H36O4Si2/c1-14(2)19(20)21-12-11-16(24(3)23-25(4,5)6)9-7-15-8-10-17-18(13-15)22-17/h15-18,24H,1,7-13H2,2-6H3 |
| InChIKey | FDJWPSZBRXSWLB-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.67 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|