C11H17N3O — CID 123625669
4-amino-6,6,8-trimethyl-1,4a,5,8a-tetrahydroquinazolin-2-one (PubChem CID 123625669) has the molecular formula C11H17N3O and a molecular weight of 207.28 g/mol. Its IUPAC name is 4-amino-6,6,8-trimethyl-1,4a,5,8a-tetrahydroquinazolin-2-one.
| Compound Name | 4-amino-6,6,8-trimethyl-1,4a,5,8a-tetrahydroquinazolin-2-one |
|---|---|
| PubChem CID | 123625669 |
| Molecular Formula | C11H17N3O |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | 4-amino-6,6,8-trimethyl-1,4a,5,8a-tetrahydroquinazolin-2-one |
| SMILES | CC1=CC(C)(C)CC2C(N)=NC(=O)NC12 |
| InChI | InChI=1S/C11H17N3O/c1-6-4-11(2,3)5-7-8(6)13-10(15)14-9(7)12/h4,7-8H,5H2,1-3H3,(H3,12,13,14,15) |
| InChIKey | BEYHBWKXHRPZQU-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|