C4H7N3O — CID 124512317
(5R)-4-amino-5-methyl-1,5-dihydroimidazol-2-one (PubChem CID 124512317) has the molecular formula C4H7N3O and a molecular weight of 113.12 g/mol. Its IUPAC name is (5R)-4-amino-5-methyl-1,5-dihydroimidazol-2-one.
| Compound Name | (5R)-4-amino-5-methyl-1,5-dihydroimidazol-2-one |
|---|---|
| PubChem CID | 124512317 |
| Molecular Formula | C4H7N3O |
| Molecular Weight | 113.12 g/mol |
| Exact Mass | 113.06 |
| IUPAC Name | (5R)-4-amino-5-methyl-1,5-dihydroimidazol-2-one |
| SMILES | C[C@H]1NC(=O)N=C1N |
| InChI | InChI=1S/C4H7N3O/c1-2-3(5)7-4(8)6-2/h2H,1H3,(H3,5,6,7,8)/t2-/m1/s1 |
| InChIKey | HGHGYCVXQBIEEI-UWTATZPHSA-N |
| XLogP | -0.54 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 113.12 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |