About (5R)-4-amino-5-methyl-1,5-dihydroimidazol-2-one
(5R)-4-amino-5-methyl-1,5-dihydroimidazol-2-one (PubChem CID 124512317) has the molecular formula C4H7N3O
and a molecular weight of 113.12 g/mol. Its IUPAC name is (5R)-4-amino-5-methyl-1,5-dihydroimidazol-2-one.
Molecular Properties
| Compound Name | (5R)-4-amino-5-methyl-1,5-dihydroimidazol-2-one |
| PubChem CID | 124512317 |
| Molecular Formula | C4H7N3O |
| Molecular Weight | 113.12 g/mol |
| Exact Mass | 113.06 |
| IUPAC Name | (5R)-4-amino-5-methyl-1,5-dihydroimidazol-2-one |
| SMILES | C[C@H]1NC(=O)N=C1N |
| InChI | InChI=1S/C4H7N3O/c1-2-3(5)7-4(8)6-2/h2H,1H3,(H3,5,6,7,8)/t2-/m1/s1 |
| InChIKey | HGHGYCVXQBIEEI-UWTATZPHSA-N |
| XLogP | -0.54 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.12 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5R)-4-amino-5-methyl-1,5-dihydroimidazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-4-amino-5-methyl-1,5-dihydroimidazol-2-one?
The IUPAC name of (5R)-4-amino-5-methyl-1,5-dihydroimidazol-2-one (CID 124512317) is (5R)-4-amino-5-methyl-1,5-dihydroimidazol-2-one.
What is the SMILES notation for (5R)-4-amino-5-methyl-1,5-dihydroimidazol-2-one?
The canonical SMILES for (5R)-4-amino-5-methyl-1,5-dihydroimidazol-2-one is C[C@H]1NC(=O)N=C1N.
What is the InChIKey of (5R)-4-amino-5-methyl-1,5-dihydroimidazol-2-one?
The InChIKey is HGHGYCVXQBIEEI-UWTATZPHSA-N. The full InChI is InChI=1S/C4H7N3O/c1-2-3(5)7-4(8)6-2/h2H,1H3,(H3,5,6,7,8)/t2-/m1/s1.
What are the key properties of (5R)-4-amino-5-methyl-1,5-dihydroimidazol-2-one?
(5R)-4-amino-5-methyl-1,5-dihydroimidazol-2-one has a molecular weight of 113.12 g/mol, XLogP of -0.54, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-4-amino-5-methyl-1,5-dihydroimidazol-2-one is sourced from PubChem (CID 124512317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).