C10H11N3O — CID 79960820
4-amino-5-(2-methylphenyl)-1,5-dihydroimidazol-2-one (PubChem CID 79960820) has the molecular formula C10H11N3O and a molecular weight of 189.22 g/mol. Its IUPAC name is 4-amino-5-(2-methylphenyl)-1,5-dihydroimidazol-2-one.
| Compound Name | 4-amino-5-(2-methylphenyl)-1,5-dihydroimidazol-2-one |
|---|---|
| PubChem CID | 79960820 |
| Molecular Formula | C10H11N3O |
| Molecular Weight | 189.22 g/mol |
| Exact Mass | 189.09 |
| IUPAC Name | 4-amino-5-(2-methylphenyl)-1,5-dihydroimidazol-2-one |
| SMILES | Cc1ccccc1C1NC(=O)N=C1N |
| InChI | InChI=1S/C10H11N3O/c1-6-4-2-3-5-7(6)8-9(11)13-10(14)12-8/h2-5,8H,1H3,(H3,11,12,13,14) |
| InChIKey | DIUYYMONZJSAKP-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.22 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |