C32H42N6O4 — CID 123626021
tert-butyl N-[3-[3-[[4-[3-butyl-5-(prop-2-enoylamino)anilino]-5-methylpyrimidin-2-yl]amino]phenoxy]propyl]carbamate (PubChem CID 123626021) has the molecular formula C32H42N6O4 and a molecular weight of 574.73 g/mol. Its IUPAC name is tert-butyl N-[3-[3-[[4-[3-butyl-5-(prop-2-enoylamino)anilino]-5-methylpyrimidin-2-yl]amino]phenoxy]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[3-[[4-[3-butyl-5-(prop-2-enoylamino)anilino]-5-methylpyrimidin-2-yl]amino]phenoxy]propyl]carbamate |
|---|---|
| PubChem CID | 123626021 |
| Molecular Formula | C32H42N6O4 |
| Molecular Weight | 574.73 g/mol |
| Exact Mass | 574.33 |
| IUPAC Name | tert-butyl N-[3-[3-[[4-[3-butyl-5-(prop-2-enoylamino)anilino]-5-methylpyrimidin-2-yl]amino]phenoxy]propyl]carbamate |
| SMILES | C=CC(=O)Nc1cc(CCCC)cc(Nc2nc(Nc3cccc(OCCCNC(=O)OC(C)(C)C)c3)ncc2C)c1 |
| InChI | InChI=1S/C32H42N6O4/c1-7-9-12-23-17-25(35-28(39)8-2)19-26(18-23)36-29-22(3)21-34-30(38-29)37-24-13-10-14-27(20-24)41-16-11-15-33-31(40)42-32(4,5)6/h8,10,13-14,17-21H,2,7,9,11-12,15-16H2,1,3-6H3,(H,33,40)(H,35,39)(H2,34,36,37,38) |
| InChIKey | BNYJZCLOTHHXIE-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 126.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.73 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|