C13H23F2NO2 — CID 123626510
tert-butyl N-(3,3-difluoro-5-methylhept-5-en-2-yl)carbamate (PubChem CID 123626510) has the molecular formula C13H23F2NO2 and a molecular weight of 263.33 g/mol. Its IUPAC name is tert-butyl N-(3,3-difluoro-5-methylhept-5-en-2-yl)carbamate.
| Compound Name | tert-butyl N-(3,3-difluoro-5-methylhept-5-en-2-yl)carbamate |
|---|---|
| PubChem CID | 123626510 |
| Molecular Formula | C13H23F2NO2 |
| Molecular Weight | 263.33 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | tert-butyl N-(3,3-difluoro-5-methylhept-5-en-2-yl)carbamate |
| SMILES | CC=C(C)CC(F)(F)C(C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H23F2NO2/c1-7-9(2)8-13(14,15)10(3)16-11(17)18-12(4,5)6/h7,10H,8H2,1-6H3,(H,16,17) |
| InChIKey | QWYMGEALRGOBCJ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.33 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|