C15H27N — CID 123626745
N-[2-methyl-4-(2-methylcyclopropyl)-5-methylideneheptan-3-yl]ethanimine (PubChem CID 123626745) has the molecular formula C15H27N and a molecular weight of 221.39 g/mol. Its IUPAC name is N-[2-methyl-4-(2-methylcyclopropyl)-5-methylideneheptan-3-yl]ethanimine.
| Compound Name | N-[2-methyl-4-(2-methylcyclopropyl)-5-methylideneheptan-3-yl]ethanimine |
|---|---|
| PubChem CID | 123626745 |
| Molecular Formula | C15H27N |
| Molecular Weight | 221.39 g/mol |
| Exact Mass | 221.21 |
| IUPAC Name | N-[2-methyl-4-(2-methylcyclopropyl)-5-methylideneheptan-3-yl]ethanimine |
| SMILES | C=C(CC)C(C1CC1C)C(/N=C/C)C(C)C |
| InChI | InChI=1S/C15H27N/c1-7-11(5)14(13-9-12(13)6)15(10(3)4)16-8-2/h8,10,12-15H,5,7,9H2,1-4,6H3/b16-8+ |
| InChIKey | IZMVCYAYBJCMHJ-LZYBPNLTSA-N |
| XLogP | 4.34 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.39 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|