C11H17N — CID 177186210
2-cyclopropyl-4-propan-2-yl-2,3-dihydropyridine (PubChem CID 177186210) has the molecular formula C11H17N and a molecular weight of 163.26 g/mol. Its IUPAC name is 2-cyclopropyl-4-propan-2-yl-2,3-dihydropyridine.
| Compound Name | 2-cyclopropyl-4-propan-2-yl-2,3-dihydropyridine |
|---|---|
| PubChem CID | 177186210 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | 2-cyclopropyl-4-propan-2-yl-2,3-dihydropyridine |
| SMILES | CC(C)C1=CC=NC(C2CC2)C1 |
| InChI | InChI=1S/C11H17N/c1-8(2)10-5-6-12-11(7-10)9-3-4-9/h5-6,8-9,11H,3-4,7H2,1-2H3 |
| InChIKey | JQDHQKMIHJJBSC-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |